About 2,3-bis(sulfanyl)propan-1-ol;dioctyltin
2,3-bis(sulfanyl)propan-1-ol;dioctyltin (PubChem CID 158959103) has the molecular formula C19H42OS2Sn
and a molecular weight of 469.39 g/mol. Its IUPAC name is 2,3-bis(sulfanyl)propan-1-ol;dioctyltin.
Molecular Properties
| Compound Name | 2,3-bis(sulfanyl)propan-1-ol;dioctyltin |
| PubChem CID | 158959103 |
| Molecular Formula | C19H42OS2Sn |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 2,3-bis(sulfanyl)propan-1-ol;dioctyltin |
| SMILES | CCCCCCCC[Sn]CCCCCCCC.OCC(S)CS |
| InChI | InChI=1S/2C8H17.C3H8OS2.Sn/c2*1-3-5-7-8-6-4-2;4-1-3(6)2-5;/h2*1,3-8H2,2H3;3-6H,1-2H2; |
| InChIKey | JMJUJTRYVNJTNO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(sulfanyl)propan-1-ol;dioctyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(sulfanyl)propan-1-ol;dioctyltin?
The IUPAC name of 2,3-bis(sulfanyl)propan-1-ol;dioctyltin (CID 158959103) is 2,3-bis(sulfanyl)propan-1-ol;dioctyltin.
What is the SMILES notation for 2,3-bis(sulfanyl)propan-1-ol;dioctyltin?
The canonical SMILES for 2,3-bis(sulfanyl)propan-1-ol;dioctyltin is CCCCCCCC[Sn]CCCCCCCC.OCC(S)CS.
What is the InChIKey of 2,3-bis(sulfanyl)propan-1-ol;dioctyltin?
The InChIKey is JMJUJTRYVNJTNO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H17.C3H8OS2.Sn/c2*1-3-5-7-8-6-4-2;4-1-3(6)2-5;/h2*1,3-8H2,2H3;3-6H,1-2H2;.
What are the key properties of 2,3-bis(sulfanyl)propan-1-ol;dioctyltin?
2,3-bis(sulfanyl)propan-1-ol;dioctyltin has a molecular weight of 469.39 g/mol, XLogP of 6.46, 16 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(sulfanyl)propan-1-ol;dioctyltin is sourced from PubChem (CID 158959103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).