C7H10HfO3 — CID 87389102
3-acetylpentane-2,4-dione;hafnium (PubChem CID 87389102) has the molecular formula C7H10HfO3 and a molecular weight of 320.64 g/mol. Its IUPAC name is 3-acetylpentane-2,4-dione;hafnium.
| Compound Name | 3-acetylpentane-2,4-dione;hafnium |
|---|---|
| PubChem CID | 87389102 |
| Molecular Formula | C7H10HfO3 |
| Molecular Weight | 320.64 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 3-acetylpentane-2,4-dione;hafnium |
| SMILES | CC(=O)C(C(C)=O)C(C)=O.[Hf] |
| InChI | InChI=1S/C7H10O3.Hf/c1-4(8)7(5(2)9)6(3)10;/h7H,1-3H3; |
| InChIKey | OCEFLFMOAMSBKX-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.64 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|