About bis(2-acetyl-3-oxobutanoate);palladium(2+)
bis(2-acetyl-3-oxobutanoate);palladium(2+) (PubChem CID 22743604) has the molecular formula C12H14O8Pd
and a molecular weight of 392.66 g/mol. Its IUPAC name is bis(2-acetyl-3-oxobutanoate);palladium(2+).
Molecular Properties
| Compound Name | bis(2-acetyl-3-oxobutanoate);palladium(2+) |
| PubChem CID | 22743604 |
| Molecular Formula | C12H14O8Pd |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | bis(2-acetyl-3-oxobutanoate);palladium(2+) |
| SMILES | CC(=O)C(C(C)=O)C(=O)[O-].CC(=O)C(C(C)=O)C(=O)[O-].[Pd+2] |
| InChI | InChI=1S/2C6H8O4.Pd/c2*1-3(7)5(4(2)8)6(9)10;/h2*5H,1-2H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | NBYAVBRGSSILQL-UHFFFAOYSA-L |
| XLogP | -2.94 |
| TPSA | 148.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(2-acetyl-3-oxobutanoate);palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-acetyl-3-oxobutanoate);palladium(2+)?
The IUPAC name of bis(2-acetyl-3-oxobutanoate);palladium(2+) (CID 22743604) is bis(2-acetyl-3-oxobutanoate);palladium(2+).
What is the SMILES notation for bis(2-acetyl-3-oxobutanoate);palladium(2+)?
The canonical SMILES for bis(2-acetyl-3-oxobutanoate);palladium(2+) is CC(=O)C(C(C)=O)C(=O)[O-].CC(=O)C(C(C)=O)C(=O)[O-].[Pd+2].
What is the InChIKey of bis(2-acetyl-3-oxobutanoate);palladium(2+)?
The InChIKey is NBYAVBRGSSILQL-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H8O4.Pd/c2*1-3(7)5(4(2)8)6(9)10;/h2*5H,1-2H3,(H,9,10);/q;;+2/p-2.
What are the key properties of bis(2-acetyl-3-oxobutanoate);palladium(2+)?
bis(2-acetyl-3-oxobutanoate);palladium(2+) has a molecular weight of 392.66 g/mol, XLogP of -2.94, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-acetyl-3-oxobutanoate);palladium(2+) is sourced from PubChem (CID 22743604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).