About 3-ethanethioylpentane-2,4-dione
3-ethanethioylpentane-2,4-dione (PubChem CID 23346848) has the molecular formula C7H10O2S
and a molecular weight of 158.22 g/mol. Its IUPAC name is 3-ethanethioylpentane-2,4-dione.
Molecular Properties
| Compound Name | 3-ethanethioylpentane-2,4-dione |
| PubChem CID | 23346848 |
| Molecular Formula | C7H10O2S |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | 3-ethanethioylpentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)C(C)=S |
| InChI | InChI=1S/C7H10O2S/c1-4(8)7(5(2)9)6(3)10/h7H,1-3H3 |
| InChIKey | QYYYHOCKDMYYFJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethanethioylpentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethanethioylpentane-2,4-dione?
The IUPAC name of 3-ethanethioylpentane-2,4-dione (CID 23346848) is 3-ethanethioylpentane-2,4-dione.
What is the SMILES notation for 3-ethanethioylpentane-2,4-dione?
The canonical SMILES for 3-ethanethioylpentane-2,4-dione is CC(=O)C(C(C)=O)C(C)=S.
What is the InChIKey of 3-ethanethioylpentane-2,4-dione?
The InChIKey is QYYYHOCKDMYYFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2S/c1-4(8)7(5(2)9)6(3)10/h7H,1-3H3.
What are the key properties of 3-ethanethioylpentane-2,4-dione?
3-ethanethioylpentane-2,4-dione has a molecular weight of 158.22 g/mol, XLogP of 1.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethanethioylpentane-2,4-dione is sourced from PubChem (CID 23346848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).