About 3-(3,3-dimethylbut-1-en-2-yl)pentane-2,4-dione
3-(3,3-dimethylbut-1-en-2-yl)pentane-2,4-dione (PubChem CID 86081358) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 3-(3,3-dimethylbut-1-en-2-yl)pentane-2,4-dione.
Molecular Properties
| Compound Name | 3-(3,3-dimethylbut-1-en-2-yl)pentane-2,4-dione |
| PubChem CID | 86081358 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 3-(3,3-dimethylbut-1-en-2-yl)pentane-2,4-dione |
| SMILES | C=C(C(C(C)=O)C(C)=O)C(C)(C)C |
| InChI | InChI=1S/C11H18O2/c1-7(11(4,5)6)10(8(2)12)9(3)13/h10H,1H2,2-6H3 |
| InChIKey | OPCUMEUQJUIAII-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3-dimethylbut-1-en-2-yl)pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-dimethylbut-1-en-2-yl)pentane-2,4-dione?
The IUPAC name of 3-(3,3-dimethylbut-1-en-2-yl)pentane-2,4-dione (CID 86081358) is 3-(3,3-dimethylbut-1-en-2-yl)pentane-2,4-dione.
What is the SMILES notation for 3-(3,3-dimethylbut-1-en-2-yl)pentane-2,4-dione?
The canonical SMILES for 3-(3,3-dimethylbut-1-en-2-yl)pentane-2,4-dione is C=C(C(C(C)=O)C(C)=O)C(C)(C)C.
What is the InChIKey of 3-(3,3-dimethylbut-1-en-2-yl)pentane-2,4-dione?
The InChIKey is OPCUMEUQJUIAII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-7(11(4,5)6)10(8(2)12)9(3)13/h10H,1H2,2-6H3.
What are the key properties of 3-(3,3-dimethylbut-1-en-2-yl)pentane-2,4-dione?
3-(3,3-dimethylbut-1-en-2-yl)pentane-2,4-dione has a molecular weight of 182.26 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethylbut-1-en-2-yl)pentane-2,4-dione is sourced from PubChem (CID 86081358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).