C13H26N2NiO3 — CID 175602645
3-acetylpentane-2,4-dione;nickel;N,N,N',N'-tetramethylethane-1,2-diamine (PubChem CID 175602645) has the molecular formula C13H26N2NiO3 and a molecular weight of 317.06 g/mol. Its IUPAC name is 3-acetylpentane-2,4-dione;nickel;N,N,N',N'-tetramethylethane-1,2-diamine.
| Compound Name | 3-acetylpentane-2,4-dione;nickel;N,N,N',N'-tetramethylethane-1,2-diamine |
|---|---|
| PubChem CID | 175602645 |
| Molecular Formula | C13H26N2NiO3 |
| Molecular Weight | 317.06 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-acetylpentane-2,4-dione;nickel;N,N,N',N'-tetramethylethane-1,2-diamine |
| SMILES | CC(=O)C(C(C)=O)C(C)=O.CN(C)CCN(C)C.[Ni] |
| InChI | InChI=1S/C7H10O3.C6H16N2.Ni/c1-4(8)7(5(2)9)6(3)10;1-7(2)5-6-8(3)4;/h7H,1-3H3;5-6H2,1-4H3; |
| InChIKey | YIEFGTOMWDTRCM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.06 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|