C8H12Cl2O6 — CID 88511729
2,3-diacetylbutanedioic acid;dihydrochloride (PubChem CID 88511729) has the molecular formula C8H12Cl2O6 and a molecular weight of 275.08 g/mol. Its IUPAC name is 2,3-diacetylbutanedioic acid;dihydrochloride.
| Compound Name | 2,3-diacetylbutanedioic acid;dihydrochloride |
|---|---|
| PubChem CID | 88511729 |
| Molecular Formula | C8H12Cl2O6 |
| Molecular Weight | 275.08 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 2,3-diacetylbutanedioic acid;dihydrochloride |
| SMILES | CC(=O)C(C(=O)O)C(C(C)=O)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C8H10O6.2ClH/c1-3(9)5(7(11)12)6(4(2)10)8(13)14;;/h5-6H,1-2H3,(H,11,12)(H,13,14);2*1H |
| InChIKey | VLBYLQQYFQEHRE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.08 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|