About acetic acid;hydrate;hydrobromide
acetic acid;hydrate;hydrobromide (PubChem CID 88815533) has the molecular formula C2H7BrO3
and a molecular weight of 158.98 g/mol. Its IUPAC name is acetic acid;hydrate;hydrobromide.
Molecular Properties
| Compound Name | acetic acid;hydrate;hydrobromide |
| PubChem CID | 88815533 |
| Molecular Formula | C2H7BrO3 |
| Molecular Weight | 158.98 g/mol |
| Exact Mass | 157.96 |
| IUPAC Name | acetic acid;hydrate;hydrobromide |
| SMILES | Br.CC(=O)O.O |
| InChI | InChI=1S/C2H4O2.BrH.H2O/c1-2(3)4;;/h1H3,(H,3,4);1H;1H2 |
| InChIKey | ZYRUJQWWYBADQA-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.98 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetic acid;hydrate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;hydrate;hydrobromide?
The IUPAC name of acetic acid;hydrate;hydrobromide (CID 88815533) is acetic acid;hydrate;hydrobromide.
What is the SMILES notation for acetic acid;hydrate;hydrobromide?
The canonical SMILES for acetic acid;hydrate;hydrobromide is Br.CC(=O)O.O.
What is the InChIKey of acetic acid;hydrate;hydrobromide?
The InChIKey is ZYRUJQWWYBADQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.BrH.H2O/c1-2(3)4;;/h1H3,(H,3,4);1H;1H2.
What are the key properties of acetic acid;hydrate;hydrobromide?
acetic acid;hydrate;hydrobromide has a molecular weight of 158.98 g/mol, XLogP of -0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;hydrate;hydrobromide is sourced from PubChem (CID 88815533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).