About acetic acid;copper;dihydrate
acetic acid;copper;dihydrate (PubChem CID 172826856) has the molecular formula C2H8CuO4
and a molecular weight of 159.63 g/mol. Its IUPAC name is acetic acid;copper;dihydrate.
Molecular Properties
| Compound Name | acetic acid;copper;dihydrate |
| PubChem CID | 172826856 |
| Molecular Formula | C2H8CuO4 |
| Molecular Weight | 159.63 g/mol |
| Exact Mass | 158.97 |
| IUPAC Name | acetic acid;copper;dihydrate |
| SMILES | CC(=O)O.O.O.[Cu] |
| InChI | InChI=1S/C2H4O2.Cu.2H2O/c1-2(3)4;;;/h1H3,(H,3,4);;2*1H2 |
| InChIKey | UZHAACHCWXGMIU-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 100.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.63 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetic acid;copper;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;copper;dihydrate?
The IUPAC name of acetic acid;copper;dihydrate (CID 172826856) is acetic acid;copper;dihydrate.
What is the SMILES notation for acetic acid;copper;dihydrate?
The canonical SMILES for acetic acid;copper;dihydrate is CC(=O)O.O.O.[Cu].
What is the InChIKey of acetic acid;copper;dihydrate?
The InChIKey is UZHAACHCWXGMIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.Cu.2H2O/c1-2(3)4;;;/h1H3,(H,3,4);;2*1H2.
What are the key properties of acetic acid;copper;dihydrate?
acetic acid;copper;dihydrate has a molecular weight of 159.63 g/mol, XLogP of -1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;copper;dihydrate is sourced from PubChem (CID 172826856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).