About acetic acid;yttrium;pentahydrate
acetic acid;yttrium;pentahydrate (PubChem CID 172997379) has the molecular formula C2H14O7Y
and a molecular weight of 239.03 g/mol. Its IUPAC name is acetic acid;yttrium;pentahydrate.
Molecular Properties
| Compound Name | acetic acid;yttrium;pentahydrate |
| PubChem CID | 172997379 |
| Molecular Formula | C2H14O7Y |
| Molecular Weight | 239.03 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | acetic acid;yttrium;pentahydrate |
| SMILES | CC(=O)O.O.O.O.O.O.[Y] |
| InChI | InChI=1S/C2H4O2.5H2O.Y/c1-2(3)4;;;;;;/h1H3,(H,3,4);5*1H2; |
| InChIKey | FMBHNOPNDLVSRS-UHFFFAOYSA-N |
| XLogP | -4.04 |
| TPSA | 194.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.03 |
| LogP ≤ 5 | -4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetic acid;yttrium;pentahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;yttrium;pentahydrate?
The IUPAC name of acetic acid;yttrium;pentahydrate (CID 172997379) is acetic acid;yttrium;pentahydrate.
What is the SMILES notation for acetic acid;yttrium;pentahydrate?
The canonical SMILES for acetic acid;yttrium;pentahydrate is CC(=O)O.O.O.O.O.O.[Y].
What is the InChIKey of acetic acid;yttrium;pentahydrate?
The InChIKey is FMBHNOPNDLVSRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.5H2O.Y/c1-2(3)4;;;;;;/h1H3,(H,3,4);5*1H2;.
What are the key properties of acetic acid;yttrium;pentahydrate?
acetic acid;yttrium;pentahydrate has a molecular weight of 239.03 g/mol, XLogP of -4.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;yttrium;pentahydrate is sourced from PubChem (CID 172997379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).