acetic acid;tin(2+);dichloride

C2H4Cl2O2Sn — CID 163897744

IUPACacetic acid;tin(2+);dichloride
SMILESCC(=O)O.[Cl-].[Cl-].[Sn+2]
InChIInChI=1S/C2H4O2.2ClH.Sn/c1-2(3)4;;;/h1H3,(H,3,4);2*1H;/q;;;+2/p-2
InChIKeyQHDRUBGAOJUXTD-UHFFFAOYSA-L
MW249.67 g/mol
LogP-6.28
Rot. Bonds

About acetic acid;tin(2+);dichloride

acetic acid;tin(2+);dichloride (PubChem CID 163897744) has the molecular formula C2H4Cl2O2Sn and a molecular weight of 249.67 g/mol. Its IUPAC name is acetic acid;tin(2+);dichloride.

Molecular Properties

Compound Nameacetic acid;tin(2+);dichloride
PubChem CID163897744
Molecular FormulaC2H4Cl2O2Sn
Molecular Weight249.67 g/mol
Exact Mass249.86
IUPAC Nameacetic acid;tin(2+);dichloride
SMILESCC(=O)O.[Cl-].[Cl-].[Sn+2]
InChIInChI=1S/C2H4O2.2ClH.Sn/c1-2(3)4;;;/h1H3,(H,3,4);2*1H;/q;;;+2/p-2
InChIKeyQHDRUBGAOJUXTD-UHFFFAOYSA-L
XLogP-6.28
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.67
LogP ≤ 5-6.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze acetic acid;tin(2+);dichloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;tin(2+);dichloride?
The IUPAC name of acetic acid;tin(2+);dichloride (CID 163897744) is acetic acid;tin(2+);dichloride.
What is the SMILES notation for acetic acid;tin(2+);dichloride?
The canonical SMILES for acetic acid;tin(2+);dichloride is CC(=O)O.[Cl-].[Cl-].[Sn+2].
What is the InChIKey of acetic acid;tin(2+);dichloride?
The InChIKey is QHDRUBGAOJUXTD-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H4O2.2ClH.Sn/c1-2(3)4;;;/h1H3,(H,3,4);2*1H;/q;;;+2/p-2.
What are the key properties of acetic acid;tin(2+);dichloride?
acetic acid;tin(2+);dichloride has a molecular weight of 249.67 g/mol, XLogP of -6.28, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;tin(2+);dichloride is sourced from PubChem (CID 163897744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).