About acetic acid;tin(2+);dichloride
acetic acid;tin(2+);dichloride (PubChem CID 163897744) has the molecular formula C2H4Cl2O2Sn
and a molecular weight of 249.67 g/mol. Its IUPAC name is acetic acid;tin(2+);dichloride.
Molecular Properties
| Compound Name | acetic acid;tin(2+);dichloride |
| PubChem CID | 163897744 |
| Molecular Formula | C2H4Cl2O2Sn |
| Molecular Weight | 249.67 g/mol |
| Exact Mass | 249.86 |
| IUPAC Name | acetic acid;tin(2+);dichloride |
| SMILES | CC(=O)O.[Cl-].[Cl-].[Sn+2] |
| InChI | InChI=1S/C2H4O2.2ClH.Sn/c1-2(3)4;;;/h1H3,(H,3,4);2*1H;/q;;;+2/p-2 |
| InChIKey | QHDRUBGAOJUXTD-UHFFFAOYSA-L |
| XLogP | -6.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.67 |
| LogP ≤ 5 | -6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetic acid;tin(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;tin(2+);dichloride?
The IUPAC name of acetic acid;tin(2+);dichloride (CID 163897744) is acetic acid;tin(2+);dichloride.
What is the SMILES notation for acetic acid;tin(2+);dichloride?
The canonical SMILES for acetic acid;tin(2+);dichloride is CC(=O)O.[Cl-].[Cl-].[Sn+2].
What is the InChIKey of acetic acid;tin(2+);dichloride?
The InChIKey is QHDRUBGAOJUXTD-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H4O2.2ClH.Sn/c1-2(3)4;;;/h1H3,(H,3,4);2*1H;/q;;;+2/p-2.
What are the key properties of acetic acid;tin(2+);dichloride?
acetic acid;tin(2+);dichloride has a molecular weight of 249.67 g/mol, XLogP of -6.28, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;tin(2+);dichloride is sourced from PubChem (CID 163897744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).