About acetic acid;lanthanum(3+);trichloride
acetic acid;lanthanum(3+);trichloride (PubChem CID 175056624) has the molecular formula C2H4Cl3LaO2
and a molecular weight of 305.32 g/mol. Its IUPAC name is acetic acid;lanthanum(3+);trichloride.
Molecular Properties
| Compound Name | acetic acid;lanthanum(3+);trichloride |
| PubChem CID | 175056624 |
| Molecular Formula | C2H4Cl3LaO2 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 303.83 |
| IUPAC Name | acetic acid;lanthanum(3+);trichloride |
| SMILES | CC(=O)O.[Cl-].[Cl-].[Cl-].[La+3] |
| InChI | InChI=1S/C2H4O2.3ClH.La/c1-2(3)4;;;;/h1H3,(H,3,4);3*1H;/q;;;;+3/p-3 |
| InChIKey | ALDVFHNEUKJCGC-UHFFFAOYSA-K |
| XLogP | -8.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | -8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetic acid;lanthanum(3+);trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;lanthanum(3+);trichloride?
The IUPAC name of acetic acid;lanthanum(3+);trichloride (CID 175056624) is acetic acid;lanthanum(3+);trichloride.
What is the SMILES notation for acetic acid;lanthanum(3+);trichloride?
The canonical SMILES for acetic acid;lanthanum(3+);trichloride is CC(=O)O.[Cl-].[Cl-].[Cl-].[La+3].
What is the InChIKey of acetic acid;lanthanum(3+);trichloride?
The InChIKey is ALDVFHNEUKJCGC-UHFFFAOYSA-K. The full InChI is InChI=1S/C2H4O2.3ClH.La/c1-2(3)4;;;;/h1H3,(H,3,4);3*1H;/q;;;;+3/p-3.
What are the key properties of acetic acid;lanthanum(3+);trichloride?
acetic acid;lanthanum(3+);trichloride has a molecular weight of 305.32 g/mol, XLogP of -8.90, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;lanthanum(3+);trichloride is sourced from PubChem (CID 175056624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).