About acetic acid;chromium;tetrahydrate
acetic acid;chromium;tetrahydrate (PubChem CID 173392510) has the molecular formula C2H12CrO6
and a molecular weight of 184.11 g/mol. Its IUPAC name is acetic acid;chromium;tetrahydrate.
Molecular Properties
| Compound Name | acetic acid;chromium;tetrahydrate |
| PubChem CID | 173392510 |
| Molecular Formula | C2H12CrO6 |
| Molecular Weight | 184.11 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | acetic acid;chromium;tetrahydrate |
| SMILES | CC(=O)O.O.O.O.O.[Cr] |
| InChI | InChI=1S/C2H4O2.Cr.4H2O/c1-2(3)4;;;;;/h1H3,(H,3,4);;4*1H2 |
| InChIKey | MDDRGVMEXJATQV-UHFFFAOYSA-N |
| XLogP | -3.21 |
| TPSA | 163.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.11 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetic acid;chromium;tetrahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;chromium;tetrahydrate?
The IUPAC name of acetic acid;chromium;tetrahydrate (CID 173392510) is acetic acid;chromium;tetrahydrate.
What is the SMILES notation for acetic acid;chromium;tetrahydrate?
The canonical SMILES for acetic acid;chromium;tetrahydrate is CC(=O)O.O.O.O.O.[Cr].
What is the InChIKey of acetic acid;chromium;tetrahydrate?
The InChIKey is MDDRGVMEXJATQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.Cr.4H2O/c1-2(3)4;;;;;/h1H3,(H,3,4);;4*1H2.
What are the key properties of acetic acid;chromium;tetrahydrate?
acetic acid;chromium;tetrahydrate has a molecular weight of 184.11 g/mol, XLogP of -3.21, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;chromium;tetrahydrate is sourced from PubChem (CID 173392510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).