About 2-bromo-1,2-diiodoethanol
2-bromo-1,2-diiodoethanol (PubChem CID 131737376) has the molecular formula C2H3BrI2O
and a molecular weight of 376.76 g/mol. Its IUPAC name is 2-bromo-1,2-diiodoethanol.
Molecular Properties
| Compound Name | 2-bromo-1,2-diiodoethanol |
| PubChem CID | 131737376 |
| Molecular Formula | C2H3BrI2O |
| Molecular Weight | 376.76 g/mol |
| Exact Mass | 375.75 |
| IUPAC Name | 2-bromo-1,2-diiodoethanol |
| SMILES | OC(I)C(Br)I |
| InChI | InChI=1S/C2H3BrI2O/c3-1(4)2(5)6/h1-2,6H |
| InChIKey | FCICJSIEJHMOLV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.76 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,2-diiodoethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,2-diiodoethanol?
The IUPAC name of 2-bromo-1,2-diiodoethanol (CID 131737376) is 2-bromo-1,2-diiodoethanol.
What is the SMILES notation for 2-bromo-1,2-diiodoethanol?
The canonical SMILES for 2-bromo-1,2-diiodoethanol is OC(I)C(Br)I.
What is the InChIKey of 2-bromo-1,2-diiodoethanol?
The InChIKey is FCICJSIEJHMOLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3BrI2O/c3-1(4)2(5)6/h1-2,6H.
What are the key properties of 2-bromo-1,2-diiodoethanol?
2-bromo-1,2-diiodoethanol has a molecular weight of 376.76 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,2-diiodoethanol is sourced from PubChem (CID 131737376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).