C4H8BrIO2 — CID 57064895
4-bromo-2-iodobutane-1,3-diol (PubChem CID 57064895) has the molecular formula C4H8BrIO2 and a molecular weight of 294.91 g/mol. Its IUPAC name is 4-bromo-2-iodobutane-1,3-diol.
| Compound Name | 4-bromo-2-iodobutane-1,3-diol |
|---|---|
| PubChem CID | 57064895 |
| Molecular Formula | C4H8BrIO2 |
| Molecular Weight | 294.91 g/mol |
| Exact Mass | 293.88 |
| IUPAC Name | 4-bromo-2-iodobutane-1,3-diol |
| SMILES | OCC(I)C(O)CBr |
| InChI | InChI=1S/C4H8BrIO2/c5-1-4(8)3(6)2-7/h3-4,7-8H,1-2H2 |
| InChIKey | AOWDNKIVPUFILK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.91 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|