C5H11BrO4 — CID 101009781
(2S,3R,4S)-5-bromopentane-1,2,3,4-tetrol (PubChem CID 101009781) has the molecular formula C5H11BrO4 and a molecular weight of 215.04 g/mol. Its IUPAC name is (2S,3R,4S)-5-bromopentane-1,2,3,4-tetrol.
| Compound Name | (2S,3R,4S)-5-bromopentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 101009781 |
| Molecular Formula | C5H11BrO4 |
| Molecular Weight | 215.04 g/mol |
| Exact Mass | 213.98 |
| IUPAC Name | (2S,3R,4S)-5-bromopentane-1,2,3,4-tetrol |
| SMILES | OC[C@H](O)[C@@H](O)[C@H](O)CBr |
| InChI | InChI=1S/C5H11BrO4/c6-1-3(8)5(10)4(9)2-7/h3-5,7-10H,1-2H2/t3-,4+,5+/m1/s1 |
| InChIKey | XYWBUTVJQGOAGJ-WISUUJSJSA-N |
| XLogP | -1.54 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.04 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|