C2H2Br4No — CID 174956331
nobelium;1,1,2,2-tetrabromoethane (PubChem CID 174956331) has the molecular formula C2H2Br4No and a molecular weight of 604.65 g/mol. Its IUPAC name is nobelium;1,1,2,2-tetrabromoethane.
| Compound Name | nobelium;1,1,2,2-tetrabromoethane |
|---|---|
| PubChem CID | 174956331 |
| Molecular Formula | C2H2Br4No |
| Molecular Weight | 604.65 g/mol |
| Exact Mass | 600.79 |
| IUPAC Name | nobelium;1,1,2,2-tetrabromoethane |
| SMILES | BrC(Br)C(Br)Br.[No] |
| InChI | InChI=1S/C2H2Br4.No/c3-1(4)2(5)6;/h1-2H; |
| InChIKey | ZFUAEXWWDLQZKF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.65 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|