C4H8Br2O2 — CID 18421052
2,2-dibromo-1-ethoxyethanol (PubChem CID 18421052) has the molecular formula C4H8Br2O2 and a molecular weight of 247.91 g/mol. Its IUPAC name is 2,2-dibromo-1-ethoxyethanol.
| Compound Name | 2,2-dibromo-1-ethoxyethanol |
|---|---|
| PubChem CID | 18421052 |
| Molecular Formula | C4H8Br2O2 |
| Molecular Weight | 247.91 g/mol |
| Exact Mass | 245.89 |
| IUPAC Name | 2,2-dibromo-1-ethoxyethanol |
| SMILES | CCOC(O)C(Br)Br |
| InChI | InChI=1S/C4H8Br2O2/c1-2-8-4(7)3(5)6/h3-4,7H,2H2,1H3 |
| InChIKey | HUETYMVQPJNJFY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.91 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|