About (2S,3R)-3-bromobutan-2-amine
(2S,3R)-3-bromobutan-2-amine (PubChem CID 13495075) has the molecular formula C4H10BrN
and a molecular weight of 152.03 g/mol. Its IUPAC name is (2S,3R)-3-bromobutan-2-amine.
Molecular Properties
| Compound Name | (2S,3R)-3-bromobutan-2-amine |
| PubChem CID | 13495075 |
| Molecular Formula | C4H10BrN |
| Molecular Weight | 152.03 g/mol |
| Exact Mass | 151.00 |
| IUPAC Name | (2S,3R)-3-bromobutan-2-amine |
| SMILES | C[C@H](N)[C@@H](C)Br |
| InChI | InChI=1S/C4H10BrN/c1-3(5)4(2)6/h3-4H,6H2,1-2H3/t3-,4+/m1/s1 |
| InChIKey | INJIQMGWSVPZFJ-DMTCNVIQSA-N |
| XLogP | 1.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.03 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S,3R)-3-bromobutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-3-bromobutan-2-amine?
The IUPAC name of (2S,3R)-3-bromobutan-2-amine (CID 13495075) is (2S,3R)-3-bromobutan-2-amine.
What is the SMILES notation for (2S,3R)-3-bromobutan-2-amine?
The canonical SMILES for (2S,3R)-3-bromobutan-2-amine is C[C@H](N)[C@@H](C)Br.
What is the InChIKey of (2S,3R)-3-bromobutan-2-amine?
The InChIKey is INJIQMGWSVPZFJ-DMTCNVIQSA-N. The full InChI is InChI=1S/C4H10BrN/c1-3(5)4(2)6/h3-4H,6H2,1-2H3/t3-,4+/m1/s1.
What are the key properties of (2S,3R)-3-bromobutan-2-amine?
(2S,3R)-3-bromobutan-2-amine has a molecular weight of 152.03 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-3-bromobutan-2-amine is sourced from PubChem (CID 13495075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).