About (2S)-3-methylbutan-2-amine;2-methylpropane
(2S)-3-methylbutan-2-amine;2-methylpropane (PubChem CID 161042679) has the molecular formula C9H23N
and a molecular weight of 145.29 g/mol. Its IUPAC name is (2S)-3-methylbutan-2-amine;2-methylpropane.
Molecular Properties
| Compound Name | (2S)-3-methylbutan-2-amine;2-methylpropane |
| PubChem CID | 161042679 |
| Molecular Formula | C9H23N |
| Molecular Weight | 145.29 g/mol |
| Exact Mass | 145.18 |
| IUPAC Name | (2S)-3-methylbutan-2-amine;2-methylpropane |
| SMILES | CC(C)C.CC(C)[C@H](C)N |
| InChI | InChI=1S/C5H13N.C4H10/c1-4(2)5(3)6;1-4(2)3/h4-5H,6H2,1-3H3;4H,1-3H3/t5-;/m0./s1 |
| InChIKey | UBBUNGCBRUDEGP-JEDNCBNOSA-N |
| XLogP | 2.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-3-methylbutan-2-amine;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-methylbutan-2-amine;2-methylpropane?
The IUPAC name of (2S)-3-methylbutan-2-amine;2-methylpropane (CID 161042679) is (2S)-3-methylbutan-2-amine;2-methylpropane.
What is the SMILES notation for (2S)-3-methylbutan-2-amine;2-methylpropane?
The canonical SMILES for (2S)-3-methylbutan-2-amine;2-methylpropane is CC(C)C.CC(C)[C@H](C)N.
What is the InChIKey of (2S)-3-methylbutan-2-amine;2-methylpropane?
The InChIKey is UBBUNGCBRUDEGP-JEDNCBNOSA-N. The full InChI is InChI=1S/C5H13N.C4H10/c1-4(2)5(3)6;1-4(2)3/h4-5H,6H2,1-3H3;4H,1-3H3/t5-;/m0./s1.
What are the key properties of (2S)-3-methylbutan-2-amine;2-methylpropane?
(2S)-3-methylbutan-2-amine;2-methylpropane has a molecular weight of 145.29 g/mol, XLogP of 2.65, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-methylbutan-2-amine;2-methylpropane is sourced from PubChem (CID 161042679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).