About O-methylhydroxylamine;propan-2-ol
O-methylhydroxylamine;propan-2-ol (PubChem CID 159942363) has the molecular formula C4H13NO2
and a molecular weight of 107.15 g/mol. Its IUPAC name is O-methylhydroxylamine;propan-2-ol.
Molecular Properties
| Compound Name | O-methylhydroxylamine;propan-2-ol |
| PubChem CID | 159942363 |
| Molecular Formula | C4H13NO2 |
| Molecular Weight | 107.15 g/mol |
| Exact Mass | 107.09 |
| IUPAC Name | O-methylhydroxylamine;propan-2-ol |
| SMILES | CC(C)O.CON |
| InChI | InChI=1S/C3H8O.CH5NO/c1-3(2)4;1-3-2/h3-4H,1-2H3;2H2,1H3 |
| InChIKey | OBAUDITYHLFYQJ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.15 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-methylhydroxylamine;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methylhydroxylamine;propan-2-ol?
The IUPAC name of O-methylhydroxylamine;propan-2-ol (CID 159942363) is O-methylhydroxylamine;propan-2-ol.
What is the SMILES notation for O-methylhydroxylamine;propan-2-ol?
The canonical SMILES for O-methylhydroxylamine;propan-2-ol is CC(C)O.CON.
What is the InChIKey of O-methylhydroxylamine;propan-2-ol?
The InChIKey is OBAUDITYHLFYQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.CH5NO/c1-3(2)4;1-3-2/h3-4H,1-2H3;2H2,1H3.
What are the key properties of O-methylhydroxylamine;propan-2-ol?
O-methylhydroxylamine;propan-2-ol has a molecular weight of 107.15 g/mol, XLogP of -0.11, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-methylhydroxylamine;propan-2-ol is sourced from PubChem (CID 159942363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).