About O-ethylhydroxylamine;propan-2-ol
O-ethylhydroxylamine;propan-2-ol (PubChem CID 174873596) has the molecular formula C5H15NO2
and a molecular weight of 121.18 g/mol. Its IUPAC name is O-ethylhydroxylamine;propan-2-ol.
Molecular Properties
| Compound Name | O-ethylhydroxylamine;propan-2-ol |
| PubChem CID | 174873596 |
| Molecular Formula | C5H15NO2 |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.11 |
| IUPAC Name | O-ethylhydroxylamine;propan-2-ol |
| SMILES | CC(C)O.CCON |
| InChI | InChI=1S/C3H8O.C2H7NO/c1-3(2)4;1-2-4-3/h3-4H,1-2H3;2-3H2,1H3 |
| InChIKey | YHDNISKBHIQKRJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-ethylhydroxylamine;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-ethylhydroxylamine;propan-2-ol?
The IUPAC name of O-ethylhydroxylamine;propan-2-ol (CID 174873596) is O-ethylhydroxylamine;propan-2-ol.
What is the SMILES notation for O-ethylhydroxylamine;propan-2-ol?
The canonical SMILES for O-ethylhydroxylamine;propan-2-ol is CC(C)O.CCON.
What is the InChIKey of O-ethylhydroxylamine;propan-2-ol?
The InChIKey is YHDNISKBHIQKRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.C2H7NO/c1-3(2)4;1-2-4-3/h3-4H,1-2H3;2-3H2,1H3.
What are the key properties of O-ethylhydroxylamine;propan-2-ol?
O-ethylhydroxylamine;propan-2-ol has a molecular weight of 121.18 g/mol, XLogP of 0.28, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-ethylhydroxylamine;propan-2-ol is sourced from PubChem (CID 174873596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).