About acetic acid;ethyl acetate;propan-2-ol
acetic acid;ethyl acetate;propan-2-ol (PubChem CID 23298224) has the molecular formula C9H20O5
and a molecular weight of 208.25 g/mol. Its IUPAC name is acetic acid;ethyl acetate;propan-2-ol.
Molecular Properties
| Compound Name | acetic acid;ethyl acetate;propan-2-ol |
| PubChem CID | 23298224 |
| Molecular Formula | C9H20O5 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | acetic acid;ethyl acetate;propan-2-ol |
| SMILES | CC(=O)O.CC(C)O.CCOC(C)=O |
| InChI | InChI=1S/C4H8O2.C3H8O.C2H4O2/c1-3-6-4(2)5;1-3(2)4;1-2(3)4/h3H2,1-2H3;3-4H,1-2H3;1H3,(H,3,4) |
| InChIKey | JNJDYRDDQVEJLH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;ethyl acetate;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;ethyl acetate;propan-2-ol?
The IUPAC name of acetic acid;ethyl acetate;propan-2-ol (CID 23298224) is acetic acid;ethyl acetate;propan-2-ol.
What is the SMILES notation for acetic acid;ethyl acetate;propan-2-ol?
The canonical SMILES for acetic acid;ethyl acetate;propan-2-ol is CC(=O)O.CC(C)O.CCOC(C)=O.
What is the InChIKey of acetic acid;ethyl acetate;propan-2-ol?
The InChIKey is JNJDYRDDQVEJLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.C3H8O.C2H4O2/c1-3-6-4(2)5;1-3(2)4;1-2(3)4/h3H2,1-2H3;3-4H,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;ethyl acetate;propan-2-ol?
acetic acid;ethyl acetate;propan-2-ol has a molecular weight of 208.25 g/mol, XLogP of 1.05, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;ethyl acetate;propan-2-ol is sourced from PubChem (CID 23298224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).