About acetic acid;butan-2-ol;ethyl acetate
acetic acid;butan-2-ol;ethyl acetate (PubChem CID 174593363) has the molecular formula C10H22O5
and a molecular weight of 222.28 g/mol. Its IUPAC name is acetic acid;butan-2-ol;ethyl acetate.
Molecular Properties
| Compound Name | acetic acid;butan-2-ol;ethyl acetate |
| PubChem CID | 174593363 |
| Molecular Formula | C10H22O5 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | acetic acid;butan-2-ol;ethyl acetate |
| SMILES | CC(=O)O.CCC(C)O.CCOC(C)=O |
| InChI | InChI=1S/C4H8O2.C4H10O.C2H4O2/c1-3-6-4(2)5;1-3-4(2)5;1-2(3)4/h3H2,1-2H3;4-5H,3H2,1-2H3;1H3,(H,3,4) |
| InChIKey | ZYPZTBCOPIOLAN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;butan-2-ol;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;butan-2-ol;ethyl acetate?
The IUPAC name of acetic acid;butan-2-ol;ethyl acetate (CID 174593363) is acetic acid;butan-2-ol;ethyl acetate.
What is the SMILES notation for acetic acid;butan-2-ol;ethyl acetate?
The canonical SMILES for acetic acid;butan-2-ol;ethyl acetate is CC(=O)O.CCC(C)O.CCOC(C)=O.
What is the InChIKey of acetic acid;butan-2-ol;ethyl acetate?
The InChIKey is ZYPZTBCOPIOLAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.C4H10O.C2H4O2/c1-3-6-4(2)5;1-3-4(2)5;1-2(3)4/h3H2,1-2H3;4-5H,3H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;butan-2-ol;ethyl acetate?
acetic acid;butan-2-ol;ethyl acetate has a molecular weight of 222.28 g/mol, XLogP of 1.44, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;butan-2-ol;ethyl acetate is sourced from PubChem (CID 174593363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).