C4H10O4 — CID 14146820
2,2-dimethoxyethane-1,1-diol (PubChem CID 14146820) has the molecular formula C4H10O4 and a molecular weight of 122.12 g/mol. Its IUPAC name is 2,2-dimethoxyethane-1,1-diol.
| Compound Name | 2,2-dimethoxyethane-1,1-diol |
|---|---|
| PubChem CID | 14146820 |
| Molecular Formula | C4H10O4 |
| Molecular Weight | 122.12 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | 2,2-dimethoxyethane-1,1-diol |
| SMILES | COC(OC)C(O)O |
| InChI | InChI=1S/C4H10O4/c1-7-4(8-2)3(5)6/h3-6H,1-2H3 |
| InChIKey | YWUQYMIRVHPYAY-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|