About 2,2-diethoxyethanol
2,2-diethoxyethanol (PubChem CID 12129) has the molecular formula C6H14O3
and a molecular weight of 134.18 g/mol. Its IUPAC name is 2,2-diethoxyethanol.
Molecular Properties
| Compound Name | 2,2-diethoxyethanol |
| PubChem CID | 12129 |
| Molecular Formula | C6H14O3 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | 2,2-diethoxyethanol |
| SMILES | CCOC(CO)OCC |
| InChI | InChI=1S/C6H14O3/c1-3-8-6(5-7)9-4-2/h6-7H,3-5H2,1-2H3 |
| InChIKey | IKKUKDZKIIIKJK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethoxyethanol?
The IUPAC name of 2,2-diethoxyethanol (CID 12129) is 2,2-diethoxyethanol.
What is the SMILES notation for 2,2-diethoxyethanol?
The canonical SMILES for 2,2-diethoxyethanol is CCOC(CO)OCC.
What is the InChIKey of 2,2-diethoxyethanol?
The InChIKey is IKKUKDZKIIIKJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3/c1-3-8-6(5-7)9-4-2/h6-7H,3-5H2,1-2H3.
What are the key properties of 2,2-diethoxyethanol?
2,2-diethoxyethanol has a molecular weight of 134.18 g/mol, XLogP of 0.38, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethoxyethanol is sourced from PubChem (CID 12129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).