About 2,2-dimethoxyethanol
2,2-dimethoxyethanol (PubChem CID 542381) has the molecular formula C4H10O3
and a molecular weight of 106.12 g/mol. Its IUPAC name is 2,2-dimethoxyethanol.
Molecular Properties
| Compound Name | 2,2-dimethoxyethanol |
| PubChem CID | 542381 |
| Molecular Formula | C4H10O3 |
| Molecular Weight | 106.12 g/mol |
| Exact Mass | 106.06 |
| IUPAC Name | 2,2-dimethoxyethanol |
| SMILES | COC(CO)OC |
| InChI | InChI=1S/C4H10O3/c1-6-4(3-5)7-2/h4-5H,3H2,1-2H3 |
| InChIKey | NYPNCQTUZYWFGG-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.12 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethoxyethanol?
The IUPAC name of 2,2-dimethoxyethanol (CID 542381) is 2,2-dimethoxyethanol.
What is the SMILES notation for 2,2-dimethoxyethanol?
The canonical SMILES for 2,2-dimethoxyethanol is COC(CO)OC.
What is the InChIKey of 2,2-dimethoxyethanol?
The InChIKey is NYPNCQTUZYWFGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3/c1-6-4(3-5)7-2/h4-5H,3H2,1-2H3.
What are the key properties of 2,2-dimethoxyethanol?
2,2-dimethoxyethanol has a molecular weight of 106.12 g/mol, XLogP of -0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethoxyethanol is sourced from PubChem (CID 542381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).