About 1-methoxyethylphosphane
1-methoxyethylphosphane (PubChem CID 18189169) has the molecular formula C3H9OP
and a molecular weight of 92.08 g/mol. Its IUPAC name is 1-methoxyethylphosphane.
Molecular Properties
| Compound Name | 1-methoxyethylphosphane |
| PubChem CID | 18189169 |
| Molecular Formula | C3H9OP |
| Molecular Weight | 92.08 g/mol |
| Exact Mass | 92.04 |
| IUPAC Name | 1-methoxyethylphosphane |
| SMILES | COC(C)P |
| InChI | InChI=1S/C3H9OP/c1-3(5)4-2/h3H,5H2,1-2H3 |
| InChIKey | IRAVNCXLKDIZQN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.08 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyethylphosphane?
The IUPAC name of 1-methoxyethylphosphane (CID 18189169) is 1-methoxyethylphosphane.
What is the SMILES notation for 1-methoxyethylphosphane?
The canonical SMILES for 1-methoxyethylphosphane is COC(C)P.
What is the InChIKey of 1-methoxyethylphosphane?
The InChIKey is IRAVNCXLKDIZQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9OP/c1-3(5)4-2/h3H,5H2,1-2H3.
What are the key properties of 1-methoxyethylphosphane?
1-methoxyethylphosphane has a molecular weight of 92.08 g/mol, XLogP of 0.85, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyethylphosphane is sourced from PubChem (CID 18189169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).