About zinc;1,1-dimethoxyethane;dichloride
zinc;1,1-dimethoxyethane;dichloride (PubChem CID 173213885) has the molecular formula C4H10Cl2O2Zn
and a molecular weight of 226.42 g/mol. Its IUPAC name is zinc;1,1-dimethoxyethane;dichloride.
Molecular Properties
| Compound Name | zinc;1,1-dimethoxyethane;dichloride |
| PubChem CID | 173213885 |
| Molecular Formula | C4H10Cl2O2Zn |
| Molecular Weight | 226.42 g/mol |
| Exact Mass | 223.93 |
| IUPAC Name | zinc;1,1-dimethoxyethane;dichloride |
| SMILES | COC(C)OC.[Cl-].[Cl-].[Zn+2] |
| InChI | InChI=1S/C4H10O2.2ClH.Zn/c1-4(5-2)6-3;;;/h4H,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | WVJPCVJCIUWXFX-UHFFFAOYSA-L |
| XLogP | -5.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.42 |
| LogP ≤ 5 | -5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze zinc;1,1-dimethoxyethane;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;1,1-dimethoxyethane;dichloride?
The IUPAC name of zinc;1,1-dimethoxyethane;dichloride (CID 173213885) is zinc;1,1-dimethoxyethane;dichloride.
What is the SMILES notation for zinc;1,1-dimethoxyethane;dichloride?
The canonical SMILES for zinc;1,1-dimethoxyethane;dichloride is COC(C)OC.[Cl-].[Cl-].[Zn+2].
What is the InChIKey of zinc;1,1-dimethoxyethane;dichloride?
The InChIKey is WVJPCVJCIUWXFX-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H10O2.2ClH.Zn/c1-4(5-2)6-3;;;/h4H,1-3H3;2*1H;/q;;;+2/p-2.
What are the key properties of zinc;1,1-dimethoxyethane;dichloride?
zinc;1,1-dimethoxyethane;dichloride has a molecular weight of 226.42 g/mol, XLogP of -5.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;1,1-dimethoxyethane;dichloride is sourced from PubChem (CID 173213885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).