C5H10K2O5 — CID 174946253
dipotassium;1,1-dimethoxyethane;carbonate (PubChem CID 174946253) has the molecular formula C5H10K2O5 and a molecular weight of 228.33 g/mol. Its IUPAC name is dipotassium;1,1-dimethoxyethane;carbonate.
| Compound Name | dipotassium;1,1-dimethoxyethane;carbonate |
|---|---|
| PubChem CID | 174946253 |
| Molecular Formula | C5H10K2O5 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | dipotassium;1,1-dimethoxyethane;carbonate |
| SMILES | COC(C)OC.O=C([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/C4H10O2.CH2O3.2K/c1-4(5-2)6-3;2-1(3)4;;/h4H,1-3H3;(H2,2,3,4);;/q;;2*+1/p-2 |
| InChIKey | OXMCPBROHQFLNY-UHFFFAOYSA-L |
| XLogP | -7.81 |
| TPSA | 81.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | -7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|