About bis(1-methoxyethyl(trimethyl)azanium);oxalate
bis(1-methoxyethyl(trimethyl)azanium);oxalate (PubChem CID 87192786) has the molecular formula C14H32N2O6
and a molecular weight of 324.42 g/mol. Its IUPAC name is bis(1-methoxyethyl(trimethyl)azanium);oxalate.
Molecular Properties
| Compound Name | bis(1-methoxyethyl(trimethyl)azanium);oxalate |
| PubChem CID | 87192786 |
| Molecular Formula | C14H32N2O6 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | bis(1-methoxyethyl(trimethyl)azanium);oxalate |
| SMILES | COC(C)[N+](C)(C)C.COC(C)[N+](C)(C)C.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/2C6H16NO.C2H2O4/c2*1-6(8-5)7(2,3)4;3-1(4)2(5)6/h2*6H,1-5H3;(H,3,4)(H,5,6)/q2*+1;/p-2 |
| InChIKey | HFPXAYAEQBSFLF-UHFFFAOYSA-L |
| XLogP | -2.14 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(1-methoxyethyl(trimethyl)azanium);oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-methoxyethyl(trimethyl)azanium);oxalate?
The IUPAC name of bis(1-methoxyethyl(trimethyl)azanium);oxalate (CID 87192786) is bis(1-methoxyethyl(trimethyl)azanium);oxalate.
What is the SMILES notation for bis(1-methoxyethyl(trimethyl)azanium);oxalate?
The canonical SMILES for bis(1-methoxyethyl(trimethyl)azanium);oxalate is COC(C)[N+](C)(C)C.COC(C)[N+](C)(C)C.O=C([O-])C(=O)[O-].
What is the InChIKey of bis(1-methoxyethyl(trimethyl)azanium);oxalate?
The InChIKey is HFPXAYAEQBSFLF-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H16NO.C2H2O4/c2*1-6(8-5)7(2,3)4;3-1(4)2(5)6/h2*6H,1-5H3;(H,3,4)(H,5,6)/q2*+1;/p-2.
What are the key properties of bis(1-methoxyethyl(trimethyl)azanium);oxalate?
bis(1-methoxyethyl(trimethyl)azanium);oxalate has a molecular weight of 324.42 g/mol, XLogP of -2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-methoxyethyl(trimethyl)azanium);oxalate is sourced from PubChem (CID 87192786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).