About methylazanide;oxalate;platinum(4+)
methylazanide;oxalate;platinum(4+) (PubChem CID 138399538) has the molecular formula C4H8N2O4Pt
and a molecular weight of 343.20 g/mol. Its IUPAC name is methylazanide;oxalate;platinum(4+).
Molecular Properties
| Compound Name | methylazanide;oxalate;platinum(4+) |
| PubChem CID | 138399538 |
| Molecular Formula | C4H8N2O4Pt |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | methylazanide;oxalate;platinum(4+) |
| SMILES | C[NH-].C[NH-].O=C([O-])C(=O)[O-].[Pt+4] |
| InChI | InChI=1S/C2H2O4.2CH4N.Pt/c3-1(4)2(5)6;2*1-2;/h(H,3,4)(H,5,6);2*2H,1H3;/q;2*-1;+4/p-2 |
| InChIKey | JFNJDHJUVNSZAX-UHFFFAOYSA-L |
| XLogP | -2.18 |
| TPSA | 127.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methylazanide;oxalate;platinum(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylazanide;oxalate;platinum(4+)?
The IUPAC name of methylazanide;oxalate;platinum(4+) (CID 138399538) is methylazanide;oxalate;platinum(4+).
What is the SMILES notation for methylazanide;oxalate;platinum(4+)?
The canonical SMILES for methylazanide;oxalate;platinum(4+) is C[NH-].C[NH-].O=C([O-])C(=O)[O-].[Pt+4].
What is the InChIKey of methylazanide;oxalate;platinum(4+)?
The InChIKey is JFNJDHJUVNSZAX-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.2CH4N.Pt/c3-1(4)2(5)6;2*1-2;/h(H,3,4)(H,5,6);2*2H,1H3;/q;2*-1;+4/p-2.
What are the key properties of methylazanide;oxalate;platinum(4+)?
methylazanide;oxalate;platinum(4+) has a molecular weight of 343.20 g/mol, XLogP of -2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylazanide;oxalate;platinum(4+) is sourced from PubChem (CID 138399538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).