C8H17NO3 — CID 158750658
1,1-dimethoxyethane;2-methylprop-2-enamide (PubChem CID 158750658) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 1,1-dimethoxyethane;2-methylprop-2-enamide.
| Compound Name | 1,1-dimethoxyethane;2-methylprop-2-enamide |
|---|---|
| PubChem CID | 158750658 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 1,1-dimethoxyethane;2-methylprop-2-enamide |
| SMILES | C=C(C)C(N)=O.COC(C)OC |
| InChI | InChI=1S/C4H7NO.C4H10O2/c1-3(2)4(5)6;1-4(5-2)6-3/h1H2,2H3,(H2,5,6);4H,1-3H3 |
| InChIKey | INKZWPUPWYPIRV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|