About 1,1-dimethoxyethane;ethyl acetate;trihydrobromide
1,1-dimethoxyethane;ethyl acetate;trihydrobromide (PubChem CID 173412257) has the molecular formula C8H21Br3O4
and a molecular weight of 420.96 g/mol. Its IUPAC name is 1,1-dimethoxyethane;ethyl acetate;trihydrobromide.
Molecular Properties
| Compound Name | 1,1-dimethoxyethane;ethyl acetate;trihydrobromide |
| PubChem CID | 173412257 |
| Molecular Formula | C8H21Br3O4 |
| Molecular Weight | 420.96 g/mol |
| Exact Mass | 417.90 |
| IUPAC Name | 1,1-dimethoxyethane;ethyl acetate;trihydrobromide |
| SMILES | Br.Br.Br.CCOC(C)=O.COC(C)OC |
| InChI | InChI=1S/C4H10O2.C4H8O2.3BrH/c1-4(5-2)6-3;1-3-6-4(2)5;;;/h4H,1-3H3;3H2,1-2H3;3*1H |
| InChIKey | KHFKZPWSLOYQRC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.96 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxyethane;ethyl acetate;trihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxyethane;ethyl acetate;trihydrobromide?
The IUPAC name of 1,1-dimethoxyethane;ethyl acetate;trihydrobromide (CID 173412257) is 1,1-dimethoxyethane;ethyl acetate;trihydrobromide.
What is the SMILES notation for 1,1-dimethoxyethane;ethyl acetate;trihydrobromide?
The canonical SMILES for 1,1-dimethoxyethane;ethyl acetate;trihydrobromide is Br.Br.Br.CCOC(C)=O.COC(C)OC.
What is the InChIKey of 1,1-dimethoxyethane;ethyl acetate;trihydrobromide?
The InChIKey is KHFKZPWSLOYQRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.C4H8O2.3BrH/c1-4(5-2)6-3;1-3-6-4(2)5;;;/h4H,1-3H3;3H2,1-2H3;3*1H.
What are the key properties of 1,1-dimethoxyethane;ethyl acetate;trihydrobromide?
1,1-dimethoxyethane;ethyl acetate;trihydrobromide has a molecular weight of 420.96 g/mol, XLogP of 2.93, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxyethane;ethyl acetate;trihydrobromide is sourced from PubChem (CID 173412257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).