C14H26N2O3 — CID 174514180
methyl 3-(tert-butylamino)-2-methylidenebutanoate;2-methylprop-2-enamide (PubChem CID 174514180) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is methyl 3-(tert-butylamino)-2-methylidenebutanoate;2-methylprop-2-enamide.
| Compound Name | methyl 3-(tert-butylamino)-2-methylidenebutanoate;2-methylprop-2-enamide |
|---|---|
| PubChem CID | 174514180 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | methyl 3-(tert-butylamino)-2-methylidenebutanoate;2-methylprop-2-enamide |
| SMILES | C=C(C(=O)OC)C(C)NC(C)(C)C.C=C(C)C(N)=O |
| InChI | InChI=1S/C10H19NO2.C4H7NO/c1-7(9(12)13-6)8(2)11-10(3,4)5;1-3(2)4(5)6/h8,11H,1H2,2-6H3;1H2,2H3,(H2,5,6) |
| InChIKey | DYZMHJKIOCYMIB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|