About 1,1-dimethoxyethane;formic acid
1,1-dimethoxyethane;formic acid (PubChem CID 174931321) has the molecular formula C5H12O4
and a molecular weight of 136.15 g/mol. Its IUPAC name is 1,1-dimethoxyethane;formic acid.
Molecular Properties
| Compound Name | 1,1-dimethoxyethane;formic acid |
| PubChem CID | 174931321 |
| Molecular Formula | C5H12O4 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 1,1-dimethoxyethane;formic acid |
| SMILES | COC(C)OC.O=CO |
| InChI | InChI=1S/C4H10O2.CH2O2/c1-4(5-2)6-3;2-1-3/h4H,1-3H3;1H,(H,2,3) |
| InChIKey | WWPMQNXTYOFKBD-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxyethane;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxyethane;formic acid?
The IUPAC name of 1,1-dimethoxyethane;formic acid (CID 174931321) is 1,1-dimethoxyethane;formic acid.
What is the SMILES notation for 1,1-dimethoxyethane;formic acid?
The canonical SMILES for 1,1-dimethoxyethane;formic acid is COC(C)OC.O=CO.
What is the InChIKey of 1,1-dimethoxyethane;formic acid?
The InChIKey is WWPMQNXTYOFKBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.CH2O2/c1-4(5-2)6-3;2-1-3/h4H,1-3H3;1H,(H,2,3).
What are the key properties of 1,1-dimethoxyethane;formic acid?
1,1-dimethoxyethane;formic acid has a molecular weight of 136.15 g/mol, XLogP of 0.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxyethane;formic acid is sourced from PubChem (CID 174931321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).