C5H12O4 — CID 174931321
1,1-dimethoxyethane;formic acid (PubChem CID 174931321) has the molecular formula C5H12O4 and a molecular weight of 136.15 g/mol. Its IUPAC name is 1,1-dimethoxyethane;formic acid.
| Compound Name | 1,1-dimethoxyethane;formic acid |
|---|---|
| PubChem CID | 174931321 |
| Molecular Formula | C5H12O4 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 1,1-dimethoxyethane;formic acid |
| SMILES | COC(C)OC.O=CO |
| InChI | InChI=1S/C4H10O2.CH2O2/c1-4(5-2)6-3;2-1-3/h4H,1-3H3;1H,(H,2,3) |
| InChIKey | WWPMQNXTYOFKBD-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|