About 1,1-dimethoxyethane;2-methoxyacetaldehyde
1,1-dimethoxyethane;2-methoxyacetaldehyde (PubChem CID 87085944) has the molecular formula C7H16O4
and a molecular weight of 164.20 g/mol. Its IUPAC name is 1,1-dimethoxyethane;2-methoxyacetaldehyde.
Molecular Properties
| Compound Name | 1,1-dimethoxyethane;2-methoxyacetaldehyde |
| PubChem CID | 87085944 |
| Molecular Formula | C7H16O4 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | 1,1-dimethoxyethane;2-methoxyacetaldehyde |
| SMILES | COC(C)OC.COCC=O |
| InChI | InChI=1S/C4H10O2.C3H6O2/c1-4(5-2)6-3;1-5-3-2-4/h4H,1-3H3;2H,3H2,1H3 |
| InChIKey | APROGJQUQRWODA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxyethane;2-methoxyacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxyethane;2-methoxyacetaldehyde?
The IUPAC name of 1,1-dimethoxyethane;2-methoxyacetaldehyde (CID 87085944) is 1,1-dimethoxyethane;2-methoxyacetaldehyde.
What is the SMILES notation for 1,1-dimethoxyethane;2-methoxyacetaldehyde?
The canonical SMILES for 1,1-dimethoxyethane;2-methoxyacetaldehyde is COC(C)OC.COCC=O.
What is the InChIKey of 1,1-dimethoxyethane;2-methoxyacetaldehyde?
The InChIKey is APROGJQUQRWODA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.C3H6O2/c1-4(5-2)6-3;1-5-3-2-4/h4H,1-3H3;2H,3H2,1H3.
What are the key properties of 1,1-dimethoxyethane;2-methoxyacetaldehyde?
1,1-dimethoxyethane;2-methoxyacetaldehyde has a molecular weight of 164.20 g/mol, XLogP of 0.46, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxyethane;2-methoxyacetaldehyde is sourced from PubChem (CID 87085944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).