C7H14Br2O3 — CID 87680521
1,3-dibromopropan-2-one;1,1-dimethoxyethane (PubChem CID 87680521) has the molecular formula C7H14Br2O3 and a molecular weight of 305.99 g/mol. Its IUPAC name is 1,3-dibromopropan-2-one;1,1-dimethoxyethane.
| Compound Name | 1,3-dibromopropan-2-one;1,1-dimethoxyethane |
|---|---|
| PubChem CID | 87680521 |
| Molecular Formula | C7H14Br2O3 |
| Molecular Weight | 305.99 g/mol |
| Exact Mass | 303.93 |
| IUPAC Name | 1,3-dibromopropan-2-one;1,1-dimethoxyethane |
| SMILES | COC(C)OC.O=C(CBr)CBr |
| InChI | InChI=1S/C4H10O2.C3H4Br2O/c1-4(5-2)6-3;4-1-3(6)2-5/h4H,1-3H3;1-2H2 |
| InChIKey | QFYKCYXEBAAGEE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.99 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|