About 1,1-dimethoxyethane;1-ethoxy-1-methoxyethane
1,1-dimethoxyethane;1-ethoxy-1-methoxyethane (PubChem CID 175467857) has the molecular formula C9H22O4
and a molecular weight of 194.27 g/mol. Its IUPAC name is 1,1-dimethoxyethane;1-ethoxy-1-methoxyethane.
Molecular Properties
| Compound Name | 1,1-dimethoxyethane;1-ethoxy-1-methoxyethane |
| PubChem CID | 175467857 |
| Molecular Formula | C9H22O4 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1,1-dimethoxyethane;1-ethoxy-1-methoxyethane |
| SMILES | CCOC(C)OC.COC(C)OC |
| InChI | InChI=1S/C5H12O2.C4H10O2/c1-4-7-5(2)6-3;1-4(5-2)6-3/h5H,4H2,1-3H3;4H,1-3H3 |
| InChIKey | YHJNHURJRVSEGM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxyethane;1-ethoxy-1-methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxyethane;1-ethoxy-1-methoxyethane?
The IUPAC name of 1,1-dimethoxyethane;1-ethoxy-1-methoxyethane (CID 175467857) is 1,1-dimethoxyethane;1-ethoxy-1-methoxyethane.
What is the SMILES notation for 1,1-dimethoxyethane;1-ethoxy-1-methoxyethane?
The canonical SMILES for 1,1-dimethoxyethane;1-ethoxy-1-methoxyethane is CCOC(C)OC.COC(C)OC.
What is the InChIKey of 1,1-dimethoxyethane;1-ethoxy-1-methoxyethane?
The InChIKey is YHJNHURJRVSEGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2.C4H10O2/c1-4-7-5(2)6-3;1-4(5-2)6-3/h5H,4H2,1-3H3;4H,1-3H3.
What are the key properties of 1,1-dimethoxyethane;1-ethoxy-1-methoxyethane?
1,1-dimethoxyethane;1-ethoxy-1-methoxyethane has a molecular weight of 194.27 g/mol, XLogP of 1.64, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxyethane;1-ethoxy-1-methoxyethane is sourced from PubChem (CID 175467857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).