C10H22O4 — CID 20578725
1,4-bis(1-methoxyethoxy)butane (PubChem CID 20578725) has the molecular formula C10H22O4 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1,4-bis(1-methoxyethoxy)butane.
| Compound Name | 1,4-bis(1-methoxyethoxy)butane |
|---|---|
| PubChem CID | 20578725 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1,4-bis(1-methoxyethoxy)butane |
| SMILES | COC(C)OCCCCOC(C)OC |
| InChI | InChI=1S/C10H22O4/c1-9(11-3)13-7-5-6-8-14-10(2)12-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | ACUBEQPXUOOPBT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|