C14H20F10O2 — CID 164552375
1,1,1,2,2-pentafluoro-6-[1-(5,5,6,6,6-pentafluorohexoxy)ethoxy]hexane (PubChem CID 164552375) has the molecular formula C14H20F10O2 and a molecular weight of 410.29 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-6-[1-(5,5,6,6,6-pentafluorohexoxy)ethoxy]hexane.
| Compound Name | 1,1,1,2,2-pentafluoro-6-[1-(5,5,6,6,6-pentafluorohexoxy)ethoxy]hexane |
|---|---|
| PubChem CID | 164552375 |
| Molecular Formula | C14H20F10O2 |
| Molecular Weight | 410.29 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-6-[1-(5,5,6,6,6-pentafluorohexoxy)ethoxy]hexane |
| SMILES | CC(OCCCCC(F)(F)C(F)(F)F)OCCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H20F10O2/c1-10(25-8-4-2-6-11(15,16)13(19,20)21)26-9-5-3-7-12(17,18)14(22,23)24/h10H,2-9H2,1H3 |
| InChIKey | OGGFNKUJNKFGJL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.29 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|