C18H26F10O4 — CID 164552473
6,6-bis(5,5,6,6,6-pentafluorohexoxy)hexanoic acid (PubChem CID 164552473) has the molecular formula C18H26F10O4 and a molecular weight of 496.38 g/mol. Its IUPAC name is 6,6-bis(5,5,6,6,6-pentafluorohexoxy)hexanoic acid.
| Compound Name | 6,6-bis(5,5,6,6,6-pentafluorohexoxy)hexanoic acid |
|---|---|
| PubChem CID | 164552473 |
| Molecular Formula | C18H26F10O4 |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 6,6-bis(5,5,6,6,6-pentafluorohexoxy)hexanoic acid |
| SMILES | O=C(O)CCCCC(OCCCCC(F)(F)C(F)(F)F)OCCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H26F10O4/c19-15(20,17(23,24)25)9-3-5-11-31-14(8-2-1-7-13(29)30)32-12-6-4-10-16(21,22)18(26,27)28/h14H,1-12H2,(H,29,30) |
| InChIKey | DDNAQMGELXYDMW-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|