C12H15F9O3 — CID 59928004
9,9,9-trifluoro-7-methoxy-8,8-bis(trifluoromethyl)nonanoic acid (PubChem CID 59928004) has the molecular formula C12H15F9O3 and a molecular weight of 378.23 g/mol. Its IUPAC name is 9,9,9-trifluoro-7-methoxy-8,8-bis(trifluoromethyl)nonanoic acid.
| Compound Name | 9,9,9-trifluoro-7-methoxy-8,8-bis(trifluoromethyl)nonanoic acid |
|---|---|
| PubChem CID | 59928004 |
| Molecular Formula | C12H15F9O3 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 9,9,9-trifluoro-7-methoxy-8,8-bis(trifluoromethyl)nonanoic acid |
| SMILES | COC(CCCCCC(=O)O)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H15F9O3/c1-24-7(5-3-2-4-6-8(22)23)9(10(13,14)15,11(16,17)18)12(19,20)21/h7H,2-6H2,1H3,(H,22,23) |
| InChIKey | QNRNQHGMPBVEFG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|