C6H6F8O — CID 98454426
1,1,1,2,2-pentafluoro-5-(trifluoromethoxy)pentane (PubChem CID 98454426) has the molecular formula C6H6F8O and a molecular weight of 246.10 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-5-(trifluoromethoxy)pentane.
| Compound Name | 1,1,1,2,2-pentafluoro-5-(trifluoromethoxy)pentane |
|---|---|
| PubChem CID | 98454426 |
| Molecular Formula | C6H6F8O |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-5-(trifluoromethoxy)pentane |
| SMILES | FC(F)(F)OCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H6F8O/c7-4(8,5(9,10)11)2-1-3-15-6(12,13)14/h1-3H2 |
| InChIKey | ZQAFEQYJNYQKQK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|