C10H21F5 — CID 167481670
ethane;1,1,1,2,2-pentafluorohexane (PubChem CID 167481670) has the molecular formula C10H21F5 and a molecular weight of 236.27 g/mol. Its IUPAC name is ethane;1,1,1,2,2-pentafluorohexane.
| Compound Name | ethane;1,1,1,2,2-pentafluorohexane |
|---|---|
| PubChem CID | 167481670 |
| Molecular Formula | C10H21F5 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | ethane;1,1,1,2,2-pentafluorohexane |
| SMILES | CC.CC.CCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H9F5.2C2H6/c1-2-3-4-5(7,8)6(9,10)11;2*1-2/h2-4H2,1H3;2*1-2H3 |
| InChIKey | XBOYKUAHFLODFE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|