C17H27F10I — CID 90829003
1,1,1,2,2-pentafluoro-8-iodooctane;1,1,1,2,2-pentafluorononane (PubChem CID 90829003) has the molecular formula C17H27F10I and a molecular weight of 548.29 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-8-iodooctane;1,1,1,2,2-pentafluorononane.
| Compound Name | 1,1,1,2,2-pentafluoro-8-iodooctane;1,1,1,2,2-pentafluorononane |
|---|---|
| PubChem CID | 90829003 |
| Molecular Formula | C17H27F10I |
| Molecular Weight | 548.29 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-8-iodooctane;1,1,1,2,2-pentafluorononane |
| SMILES | CCCCCCCC(F)(F)C(F)(F)F.FC(F)(F)C(F)(F)CCCCCCI |
| InChI | InChI=1S/C9H15F5.C8H12F5I/c1-2-3-4-5-6-7-8(10,11)9(12,13)14;9-7(10,8(11,12)13)5-3-1-2-4-6-14/h2-7H2,1H3;1-6H2 |
| InChIKey | GWCLWPMBCBMVCR-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.29 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|