C16H29F5 — CID 126695237
6-(3,3,4,4,4-pentafluorobutyl)dodecane (PubChem CID 126695237) has the molecular formula C16H29F5 and a molecular weight of 316.40 g/mol. Its IUPAC name is 6-(3,3,4,4,4-pentafluorobutyl)dodecane.
| Compound Name | 6-(3,3,4,4,4-pentafluorobutyl)dodecane |
|---|---|
| PubChem CID | 126695237 |
| Molecular Formula | C16H29F5 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 6-(3,3,4,4,4-pentafluorobutyl)dodecane |
| SMILES | CCCCCCC(CCCCC)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H29F5/c1-3-5-7-9-11-14(10-8-6-4-2)12-13-15(17,18)16(19,20)21/h14H,3-13H2,1-2H3 |
| InChIKey | CRYKLCXLKPJPQC-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|