C10H16F6 — CID 162621098
4,4-bis(trifluoromethyl)octane (PubChem CID 162621098) has the molecular formula C10H16F6 and a molecular weight of 250.23 g/mol. Its IUPAC name is 4,4-bis(trifluoromethyl)octane.
| Compound Name | 4,4-bis(trifluoromethyl)octane |
|---|---|
| PubChem CID | 162621098 |
| Molecular Formula | C10H16F6 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 4,4-bis(trifluoromethyl)octane |
| SMILES | CCCCC(CCC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H16F6/c1-3-5-7-8(6-4-2,9(11,12)13)10(14,15)16/h3-7H2,1-2H3 |
| InChIKey | GOCDUJFMJSQXRJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |