C7H6Cl3F7O — CID 151300739
1,1,1-trichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butane (PubChem CID 151300739) has the molecular formula C7H6Cl3F7O and a molecular weight of 345.47 g/mol. Its IUPAC name is 1,1,1-trichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butane.
| Compound Name | 1,1,1-trichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butane |
|---|---|
| PubChem CID | 151300739 |
| Molecular Formula | C7H6Cl3F7O |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 343.94 |
| IUPAC Name | 1,1,1-trichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butane |
| SMILES | FC(F)(F)C(F)(OCCCC(Cl)(Cl)Cl)C(F)(F)F |
| InChI | InChI=1S/C7H6Cl3F7O/c8-4(9,10)2-1-3-18-5(11,6(12,13)14)7(15,16)17/h1-3H2 |
| InChIKey | OCJFYLNBRVFBIQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|