C6H6F7NO2 — CID 139724193
3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)propanamide (PubChem CID 139724193) has the molecular formula C6H6F7NO2 and a molecular weight of 257.10 g/mol. Its IUPAC name is 3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)propanamide.
| Compound Name | 3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)propanamide |
|---|---|
| PubChem CID | 139724193 |
| Molecular Formula | C6H6F7NO2 |
| Molecular Weight | 257.10 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)propanamide |
| SMILES | NC(=O)CCOC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H6F7NO2/c7-4(5(8,9)10,6(11,12)13)16-2-1-3(14)15/h1-2H2,(H2,14,15) |
| InChIKey | SEFLCKCNWXGHMX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.10 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |